C37H42O8 — CID 162864138
4-benzyl-8-[1-(3,4-dihydroxyphenyl)-2-hydroxycyclohexyl]-9-hydroxy-3-[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]cyclodec-5-yn-1-one (PubChem CID 162864138) has the molecular formula C37H42O8 and a molecular weight of 614.74 g/mol. Its IUPAC name is 4-benzyl-8-[1-(3,4-dihydroxyphenyl)-2-hydroxycyclohexyl]-9-hydroxy-3-[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]cyclodec-5-yn-1-one.
| Compound Name | 4-benzyl-8-[1-(3,4-dihydroxyphenyl)-2-hydroxycyclohexyl]-9-hydroxy-3-[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]cyclodec-5-yn-1-one |
|---|---|
| PubChem CID | 162864138 |
| Molecular Formula | C37H42O8 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.29 |
| IUPAC Name | 4-benzyl-8-[1-(3,4-dihydroxyphenyl)-2-hydroxycyclohexyl]-9-hydroxy-3-[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]cyclodec-5-yn-1-one |
| SMILES | COc1cc(C2CC(=O)CC(O)C(C3(c4ccc(O)c(O)c4)CCCCC3O)CC#CC2Cc2ccccc2)c(CO)cc1O |
| InChI | InChI=1S/C37H42O8/c1-45-35-21-29(25(22-38)17-34(35)43)28-19-27(39)20-32(41)30(11-7-10-24(28)16-23-8-3-2-4-9-23)37(15-6-5-12-36(37)44)26-13-14-31(40)33(42)18-26/h2-4,8-9,13-14,17-18,21,24,28,30,32,36,38,40-44H,5-6,11-12,15-16,19-20,22H2,1H3 |
| InChIKey | UEUQEHKYSQELCW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|