C37H40O6 — CID 162836970
(1R,5S,6S,10S,11S,15S)-6-benzyl-11-(3,4-dihydroxyphenyl)-1-hydroxy-5-(4-hydroxy-3-methoxyphenyl)tricyclo[8.7.0.011,15]heptadec-7-yn-3-one (PubChem CID 162836970) has the molecular formula C37H40O6 and a molecular weight of 580.72 g/mol. Its IUPAC name is (1R,5S,6S,10S,11S,15S)-6-benzyl-11-(3,4-dihydroxyphenyl)-1-hydroxy-5-(4-hydroxy-3-methoxyphenyl)tricyclo[8.7.0.011,15]heptadec-7-yn-3-one.
| Compound Name | (1R,5S,6S,10S,11S,15S)-6-benzyl-11-(3,4-dihydroxyphenyl)-1-hydroxy-5-(4-hydroxy-3-methoxyphenyl)tricyclo[8.7.0.011,15]heptadec-7-yn-3-one |
|---|---|
| PubChem CID | 162836970 |
| Molecular Formula | C37H40O6 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | (1R,5S,6S,10S,11S,15S)-6-benzyl-11-(3,4-dihydroxyphenyl)-1-hydroxy-5-(4-hydroxy-3-methoxyphenyl)tricyclo[8.7.0.011,15]heptadec-7-yn-3-one |
| SMILES | COc1cc([C@H]2CC(=O)C[C@]3(O)CC[C@@H]4CCC[C@@]4(c4ccc(O)c(O)c4)[C@@H]3CC#C[C@H]2Cc2ccccc2)ccc1O |
| InChI | InChI=1S/C37H40O6/c1-43-34-20-26(12-14-32(34)40)30-22-29(38)23-36(42)18-16-27-10-6-17-37(27,28-13-15-31(39)33(41)21-28)35(36)11-5-9-25(30)19-24-7-3-2-4-8-24/h2-4,7-8,12-15,20-21,25,27,30,35,39-42H,6,10-11,16-19,22-23H2,1H3/t25-,27-,30-,35+,36+,37+/m0/s1 |
| InChIKey | JNLXJCUDLSTCEB-JORWKHFHSA-N |
| XLogP | 6.39 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|