C17H24O2 — CID 10236249
4-(7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl)-2-methoxyphenol (PubChem CID 10236249) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 4-(7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl)-2-methoxyphenol.
| Compound Name | 4-(7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl)-2-methoxyphenol |
|---|---|
| PubChem CID | 10236249 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 4-(7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl)-2-methoxyphenol |
| SMILES | COc1cc(C2CCC3(C)CCCC3C2)ccc1O |
| InChI | InChI=1S/C17H24O2/c1-17-8-3-4-14(17)10-13(7-9-17)12-5-6-15(18)16(11-12)19-2/h5-6,11,13-14,18H,3-4,7-10H2,1-2H3 |
| InChIKey | ITAGEPWJRFUVRZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |