C12H17NO2 — CID 82228517
2-methoxy-4-[2-(methylaminomethyl)cyclopropyl]phenol (PubChem CID 82228517) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-methoxy-4-[2-(methylaminomethyl)cyclopropyl]phenol.
| Compound Name | 2-methoxy-4-[2-(methylaminomethyl)cyclopropyl]phenol |
|---|---|
| PubChem CID | 82228517 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-methoxy-4-[2-(methylaminomethyl)cyclopropyl]phenol |
| SMILES | CNCC1CC1c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C12H17NO2/c1-13-7-9-5-10(9)8-3-4-11(14)12(6-8)15-2/h3-4,6,9-10,13-14H,5,7H2,1-2H3 |
| InChIKey | XBJAEGXWMKITGJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |