C13H19NO2 — CID 115978487
2-methoxy-4-[[(2-methylcyclopropyl)methylamino]methyl]phenol (PubChem CID 115978487) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-methoxy-4-[[(2-methylcyclopropyl)methylamino]methyl]phenol.
| Compound Name | 2-methoxy-4-[[(2-methylcyclopropyl)methylamino]methyl]phenol |
|---|---|
| PubChem CID | 115978487 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-methoxy-4-[[(2-methylcyclopropyl)methylamino]methyl]phenol |
| SMILES | COc1cc(CNCC2CC2C)ccc1O |
| InChI | InChI=1S/C13H19NO2/c1-9-5-11(9)8-14-7-10-3-4-12(15)13(6-10)16-2/h3-4,6,9,11,14-15H,5,7-8H2,1-2H3 |
| InChIKey | FCMYKBLRKMZNPH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |