C12H16FNO — CID 103948125
4-fluoro-2-[[(2-methylcyclopropyl)methylamino]methyl]phenol (PubChem CID 103948125) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is 4-fluoro-2-[[(2-methylcyclopropyl)methylamino]methyl]phenol.
| Compound Name | 4-fluoro-2-[[(2-methylcyclopropyl)methylamino]methyl]phenol |
|---|---|
| PubChem CID | 103948125 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 4-fluoro-2-[[(2-methylcyclopropyl)methylamino]methyl]phenol |
| SMILES | CC1CC1CNCc1cc(F)ccc1O |
| InChI | InChI=1S/C12H16FNO/c1-8-4-9(8)6-14-7-10-5-11(13)2-3-12(10)15/h2-3,5,8-9,14-15H,4,6-7H2,1H3 |
| InChIKey | ZIWBMXSUBXSYBN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|