C33H50N4O5 — CID 162837815
[(1S,2R,6S,9S)-9-hydroxy-2-[(4-hydroxy-3-piperidin-4-yloxyphenyl)methyl]-6-[[(N'-methylcarbamimidoyl)amino]methyl]-6-(1-methylcyclopentyl)cyclodec-4-yn-1-yl] acetate (PubChem CID 162837815) has the molecular formula C33H50N4O5 and a molecular weight of 582.79 g/mol. Its IUPAC name is [(1S,2R,6S,9S)-9-hydroxy-2-[(4-hydroxy-3-piperidin-4-yloxyphenyl)methyl]-6-[[(N'-methylcarbamimidoyl)amino]methyl]-6-(1-methylcyclopentyl)cyclodec-4-yn-1-yl] acetate.
| Compound Name | [(1S,2R,6S,9S)-9-hydroxy-2-[(4-hydroxy-3-piperidin-4-yloxyphenyl)methyl]-6-[[(N'-methylcarbamimidoyl)amino]methyl]-6-(1-methylcyclopentyl)cyclodec-4-yn-1-yl] acetate |
|---|---|
| PubChem CID | 162837815 |
| Molecular Formula | C33H50N4O5 |
| Molecular Weight | 582.79 g/mol |
| Exact Mass | 582.38 |
| IUPAC Name | [(1S,2R,6S,9S)-9-hydroxy-2-[(4-hydroxy-3-piperidin-4-yloxyphenyl)methyl]-6-[[(N'-methylcarbamimidoyl)amino]methyl]-6-(1-methylcyclopentyl)cyclodec-4-yn-1-yl] acetate |
| SMILES | C/N=C(\N)NC[C@@]1(C2(C)CCCC2)C#CC[C@@H](Cc2ccc(O)c(OC3CCNCC3)c2)[C@@H](OC(C)=O)C[C@@H](O)CC1 |
| InChI | InChI=1S/C33H50N4O5/c1-23(38)41-29-21-26(39)10-16-33(22-37-31(34)35-3,32(2)13-4-5-14-32)15-6-7-25(29)19-24-8-9-28(40)30(20-24)42-27-11-17-36-18-12-27/h8-9,20,25-27,29,36,39-40H,4-5,7,10-14,16-19,21-22H2,1-3H3,(H3,34,35,37)/t25-,26-,29-,33+/m0/s1 |
| InChIKey | ZPYCWZUWCIRQJP-VXXLZUJLSA-N |
| XLogP | 3.65 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.79 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|