C23H32O6 — CID 163060772
[6-ethyl-9-hydroxy-2-[[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]methyl]cyclodec-4-yn-1-yl] acetate (PubChem CID 163060772) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is [6-ethyl-9-hydroxy-2-[[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]methyl]cyclodec-4-yn-1-yl] acetate.
| Compound Name | [6-ethyl-9-hydroxy-2-[[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]methyl]cyclodec-4-yn-1-yl] acetate |
|---|---|
| PubChem CID | 163060772 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | [6-ethyl-9-hydroxy-2-[[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]methyl]cyclodec-4-yn-1-yl] acetate |
| SMILES | CCC1C#CCC(Cc2cc(OC)c(O)cc2CO)C(OC(C)=O)CC(O)CC1 |
| InChI | InChI=1S/C23H32O6/c1-4-16-6-5-7-17(22(29-15(2)25)13-20(26)9-8-16)10-18-12-23(28-3)21(27)11-19(18)14-24/h11-12,16-17,20,22,24,26-27H,4,7-10,13-14H2,1-3H3 |
| InChIKey | CGWNCTNUMDJXCF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|