C31H37NO5 — CID 162829289
[9-hydroxy-2-[(4-hydroxy-3-methoxyphenyl)methyl]-6-[3-(1H-indol-3-yl)propyl]cyclodec-4-yn-1-yl] acetate (PubChem CID 162829289) has the molecular formula C31H37NO5 and a molecular weight of 503.64 g/mol. Its IUPAC name is [9-hydroxy-2-[(4-hydroxy-3-methoxyphenyl)methyl]-6-[3-(1H-indol-3-yl)propyl]cyclodec-4-yn-1-yl] acetate.
| Compound Name | [9-hydroxy-2-[(4-hydroxy-3-methoxyphenyl)methyl]-6-[3-(1H-indol-3-yl)propyl]cyclodec-4-yn-1-yl] acetate |
|---|---|
| PubChem CID | 162829289 |
| Molecular Formula | C31H37NO5 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | [9-hydroxy-2-[(4-hydroxy-3-methoxyphenyl)methyl]-6-[3-(1H-indol-3-yl)propyl]cyclodec-4-yn-1-yl] acetate |
| SMILES | COc1cc(CC2CC#CC(CCCc3c[nH]c4ccccc34)CCC(O)CC2OC(C)=O)ccc1O |
| InChI | InChI=1S/C31H37NO5/c1-21(33)37-30-19-26(34)15-13-22(8-6-10-25-20-32-28-12-4-3-11-27(25)28)7-5-9-24(30)17-23-14-16-29(35)31(18-23)36-2/h3-4,11-12,14,16,18,20,22,24,26,30,32,34-35H,6,8-10,13,15,17,19H2,1-2H3 |
| InChIKey | ZHAUMMLOURMKNH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|