C27H32N2O11 — CID 95369597
methyl (2R)-3-(1H-indol-3-yl)-2-[[(3S,5S)-1,3,4,5-tetraacetyloxycyclohexanecarbonyl]amino]propanoate (PubChem CID 95369597) has the molecular formula C27H32N2O11 and a molecular weight of 560.56 g/mol. Its IUPAC name is methyl (2R)-3-(1H-indol-3-yl)-2-[[(3S,5S)-1,3,4,5-tetraacetyloxycyclohexanecarbonyl]amino]propanoate.
| Compound Name | methyl (2R)-3-(1H-indol-3-yl)-2-[[(3S,5S)-1,3,4,5-tetraacetyloxycyclohexanecarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 95369597 |
| Molecular Formula | C27H32N2O11 |
| Molecular Weight | 560.56 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | methyl (2R)-3-(1H-indol-3-yl)-2-[[(3S,5S)-1,3,4,5-tetraacetyloxycyclohexanecarbonyl]amino]propanoate |
| SMILES | COC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)C1(OC(C)=O)C[C@H](OC(C)=O)C(OC(C)=O)[C@@H](OC(C)=O)C1 |
| InChI | InChI=1S/C27H32N2O11/c1-14(30)37-22-11-27(40-17(4)33,12-23(38-15(2)31)24(22)39-16(3)32)26(35)29-21(25(34)36-5)10-18-13-28-20-9-7-6-8-19(18)20/h6-9,13,21-24,28H,10-12H2,1-5H3,(H,29,35)/t21-,22+,23+,24?,27?/m1/s1 |
| InChIKey | HQJMMMNUCZFHGX-DOSBHYPPSA-N |
| XLogP | 1.26 |
| TPSA | 176.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.56 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|