C23H30N2O2 — CID 46933271
methyl (2S)-2-(1-adamantylmethylamino)-3-(1H-indol-3-yl)propanoate (PubChem CID 46933271) has the molecular formula C23H30N2O2 and a molecular weight of 366.50 g/mol. Its IUPAC name is methyl (2S)-2-(1-adamantylmethylamino)-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl (2S)-2-(1-adamantylmethylamino)-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 46933271 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | methyl (2S)-2-(1-adamantylmethylamino)-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)[C@H](Cc1c[nH]c2ccccc12)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H30N2O2/c1-27-22(26)21(9-18-13-24-20-5-3-2-4-19(18)20)25-14-23-10-15-6-16(11-23)8-17(7-15)12-23/h2-5,13,15-17,21,24-25H,6-12,14H2,1H3/t15?,16?,17?,21-,23?/m0/s1 |
| InChIKey | GFLRVMQLKYSFJM-RWENRRORSA-N |
| XLogP | 4.06 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |