C14H17N2O2PS3 — CID 102009011
methyl 3-(1H-indol-3-yl)-2-[(2-sulfido-1,3,2-dithiaphospholan-2-ium-2-yl)amino]propanoate (PubChem CID 102009011) has the molecular formula C14H17N2O2PS3 and a molecular weight of 372.48 g/mol. Its IUPAC name is methyl 3-(1H-indol-3-yl)-2-[(2-sulfido-1,3,2-dithiaphospholan-2-ium-2-yl)amino]propanoate.
| Compound Name | methyl 3-(1H-indol-3-yl)-2-[(2-sulfido-1,3,2-dithiaphospholan-2-ium-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 102009011 |
| Molecular Formula | C14H17N2O2PS3 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | methyl 3-(1H-indol-3-yl)-2-[(2-sulfido-1,3,2-dithiaphospholan-2-ium-2-yl)amino]propanoate |
| SMILES | COC(=O)C(Cc1c[nH]c2ccccc12)N[P+]1([S-])SCCS1 |
| InChI | InChI=1S/C14H17N2O2PS3/c1-18-14(17)13(16-19(20)21-6-7-22-19)8-10-9-15-12-5-3-2-4-11(10)12/h2-5,9,13,15H,6-8H2,1H3,(H,16,20) |
| InChIKey | GFZXGOPKYADSHI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|