C14H17N2O3PS2 — CID 11348833
methyl (2S)-3-(1H-indol-3-yl)-2-[(2-sulfanylidene-1,3,2λ5-oxathiaphospholan-2-yl)amino]propanoate (PubChem CID 11348833) has the molecular formula C14H17N2O3PS2 and a molecular weight of 356.41 g/mol. Its IUPAC name is methyl (2S)-3-(1H-indol-3-yl)-2-[(2-sulfanylidene-1,3,2λ5-oxathiaphospholan-2-yl)amino]propanoate.
| Compound Name | methyl (2S)-3-(1H-indol-3-yl)-2-[(2-sulfanylidene-1,3,2λ5-oxathiaphospholan-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 11348833 |
| Molecular Formula | C14H17N2O3PS2 |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | methyl (2S)-3-(1H-indol-3-yl)-2-[(2-sulfanylidene-1,3,2λ5-oxathiaphospholan-2-yl)amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1c[nH]c2ccccc12)NP1(=S)OCCS1 |
| InChI | InChI=1S/C14H17N2O3PS2/c1-18-14(17)13(16-20(21)19-6-7-22-20)8-10-9-15-12-5-3-2-4-11(10)12/h2-5,9,13,15H,6-8H2,1H3,(H,16,21)/t13-,20?/m0/s1 |
| InChIKey | IRYQIGOIRFSVFB-SZQRVLIRSA-N |
| XLogP | 2.83 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|