C23H27NO5 — CID 162747260
[4-[3-[[2-(4-hydroxy-3-methoxyphenyl)acetyl]amino]phenyl]cyclohexyl] acetate (PubChem CID 162747260) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is [4-[3-[[2-(4-hydroxy-3-methoxyphenyl)acetyl]amino]phenyl]cyclohexyl] acetate.
| Compound Name | [4-[3-[[2-(4-hydroxy-3-methoxyphenyl)acetyl]amino]phenyl]cyclohexyl] acetate |
|---|---|
| PubChem CID | 162747260 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [4-[3-[[2-(4-hydroxy-3-methoxyphenyl)acetyl]amino]phenyl]cyclohexyl] acetate |
| SMILES | COc1cc(CC(=O)Nc2cccc(C3CCC(OC(C)=O)CC3)c2)ccc1O |
| InChI | InChI=1S/C23H27NO5/c1-15(25)29-20-9-7-17(8-10-20)18-4-3-5-19(14-18)24-23(27)13-16-6-11-21(26)22(12-16)28-2/h3-6,11-12,14,17,20,26H,7-10,13H2,1-2H3,(H,24,27) |
| InChIKey | JTNPOEQDEYARFM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |