C30H27NO5 — CID 168859417
[3-[3-[[2-(4-hydroxy-3-methoxyphenyl)acetyl]amino]phenyl]phenyl] 2-(4-methylphenyl)acetate (PubChem CID 168859417) has the molecular formula C30H27NO5 and a molecular weight of 481.55 g/mol. Its IUPAC name is [3-[3-[[2-(4-hydroxy-3-methoxyphenyl)acetyl]amino]phenyl]phenyl] 2-(4-methylphenyl)acetate.
| Compound Name | [3-[3-[[2-(4-hydroxy-3-methoxyphenyl)acetyl]amino]phenyl]phenyl] 2-(4-methylphenyl)acetate |
|---|---|
| PubChem CID | 168859417 |
| Molecular Formula | C30H27NO5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | [3-[3-[[2-(4-hydroxy-3-methoxyphenyl)acetyl]amino]phenyl]phenyl] 2-(4-methylphenyl)acetate |
| SMILES | COc1cc(CC(=O)Nc2cccc(-c3cccc(OC(=O)Cc4ccc(C)cc4)c3)c2)ccc1O |
| InChI | InChI=1S/C30H27NO5/c1-20-9-11-21(12-10-20)17-30(34)36-26-8-4-6-24(19-26)23-5-3-7-25(18-23)31-29(33)16-22-13-14-27(32)28(15-22)35-2/h3-15,18-19,32H,16-17H2,1-2H3,(H,31,33) |
| InChIKey | RUDKZMKVZCHCMA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|