C23H21NO3 — CID 58679871
2-(4-hydroxy-3-methoxyphenyl)-N-[3-[(Z)-2-phenylethenyl]phenyl]acetamide (PubChem CID 58679871) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-(4-hydroxy-3-methoxyphenyl)-N-[3-[(Z)-2-phenylethenyl]phenyl]acetamide.
| Compound Name | 2-(4-hydroxy-3-methoxyphenyl)-N-[3-[(Z)-2-phenylethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 58679871 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-(4-hydroxy-3-methoxyphenyl)-N-[3-[(Z)-2-phenylethenyl]phenyl]acetamide |
| SMILES | COc1cc(CC(=O)Nc2cccc(/C=C\c3ccccc3)c2)ccc1O |
| InChI | InChI=1S/C23H21NO3/c1-27-22-15-19(12-13-21(22)25)16-23(26)24-20-9-5-8-18(14-20)11-10-17-6-3-2-4-7-17/h2-15,25H,16H2,1H3,(H,24,26)/b11-10- |
| InChIKey | PVICPCLRSIPWED-KHPPLWFESA-N |
| XLogP | 4.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|