C27H35NO4 — CID 142193429
[4-[2-[3-(4-butylcyclohexyl)anilino]-2-oxoethyl]-2-methoxyphenyl] acetate (PubChem CID 142193429) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is [4-[2-[3-(4-butylcyclohexyl)anilino]-2-oxoethyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[2-[3-(4-butylcyclohexyl)anilino]-2-oxoethyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 142193429 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | [4-[2-[3-(4-butylcyclohexyl)anilino]-2-oxoethyl]-2-methoxyphenyl] acetate |
| SMILES | CCCCC1CCC(c2cccc(NC(=O)Cc3ccc(OC(C)=O)c(OC)c3)c2)CC1 |
| InChI | InChI=1S/C27H35NO4/c1-4-5-7-20-10-13-22(14-11-20)23-8-6-9-24(18-23)28-27(30)17-21-12-15-25(32-19(2)29)26(16-21)31-3/h6,8-9,12,15-16,18,20,22H,4-5,7,10-11,13-14,17H2,1-3H3,(H,28,30) |
| InChIKey | HGLCGFUFDZJZQZ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|