C26H39N3O6 — CID 163073991
[(1S,2R,6R,9S)-6-ethyl-9-hydroxy-2-[[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]methyl]-6-[[(N'-methylcarbamimidoyl)amino]methyl]cyclodec-4-yn-1-yl] acetate (PubChem CID 163073991) has the molecular formula C26H39N3O6 and a molecular weight of 489.61 g/mol. Its IUPAC name is [(1S,2R,6R,9S)-6-ethyl-9-hydroxy-2-[[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]methyl]-6-[[(N'-methylcarbamimidoyl)amino]methyl]cyclodec-4-yn-1-yl] acetate.
| Compound Name | [(1S,2R,6R,9S)-6-ethyl-9-hydroxy-2-[[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]methyl]-6-[[(N'-methylcarbamimidoyl)amino]methyl]cyclodec-4-yn-1-yl] acetate |
|---|---|
| PubChem CID | 163073991 |
| Molecular Formula | C26H39N3O6 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | [(1S,2R,6R,9S)-6-ethyl-9-hydroxy-2-[[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]methyl]-6-[[(N'-methylcarbamimidoyl)amino]methyl]cyclodec-4-yn-1-yl] acetate |
| SMILES | CC[C@]1(CN/C(N)=N/C)C#CC[C@H](Cc2cc(OC)c(O)cc2CO)[C@@H](OC(C)=O)C[C@@H](O)CC1 |
| InChI | InChI=1S/C26H39N3O6/c1-5-26(16-29-25(27)28-3)9-6-7-18(23(35-17(2)31)14-21(32)8-10-26)11-19-13-24(34-4)22(33)12-20(19)15-30/h12-13,18,21,23,30,32-33H,5,7-8,10-11,14-16H2,1-4H3,(H3,27,28,29)/t18-,21+,23+,26+/m1/s1 |
| InChIKey | MPKFVBYCAZOQPA-KGCPGCNSSA-N |
| XLogP | 1.85 |
| TPSA | 146.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|