C32H48N4O6 — CID 163093435
[(5R,6S,9S,11S,12S)-9-hydroxy-12-[[4-hydroxy-2-(hydroxymethyl)-5-piperidin-4-yloxyphenyl]methyl]-5-[(N'-methylcarbamimidoyl)amino]spiro[5.9]pentadec-14-yn-11-yl] acetate (PubChem CID 163093435) has the molecular formula C32H48N4O6 and a molecular weight of 584.76 g/mol. Its IUPAC name is [(5R,6S,9S,11S,12S)-9-hydroxy-12-[[4-hydroxy-2-(hydroxymethyl)-5-piperidin-4-yloxyphenyl]methyl]-5-[(N'-methylcarbamimidoyl)amino]spiro[5.9]pentadec-14-yn-11-yl] acetate.
| Compound Name | [(5R,6S,9S,11S,12S)-9-hydroxy-12-[[4-hydroxy-2-(hydroxymethyl)-5-piperidin-4-yloxyphenyl]methyl]-5-[(N'-methylcarbamimidoyl)amino]spiro[5.9]pentadec-14-yn-11-yl] acetate |
|---|---|
| PubChem CID | 163093435 |
| Molecular Formula | C32H48N4O6 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.36 |
| IUPAC Name | [(5R,6S,9S,11S,12S)-9-hydroxy-12-[[4-hydroxy-2-(hydroxymethyl)-5-piperidin-4-yloxyphenyl]methyl]-5-[(N'-methylcarbamimidoyl)amino]spiro[5.9]pentadec-14-yn-11-yl] acetate |
| SMILES | C/N=C(\N)N[C@@H]1CCCC[C@]12C#CC[C@@H](Cc1cc(OC3CCNCC3)c(O)cc1CO)[C@@H](OC(C)=O)C[C@@H](O)CC2 |
| InChI | InChI=1S/C32H48N4O6/c1-21(38)41-28-19-25(39)8-13-32(11-4-3-7-30(32)36-31(33)34-2)12-5-6-22(28)16-23-18-29(27(40)17-24(23)20-37)42-26-9-14-35-15-10-26/h17-18,22,25-26,28,30,35,37,39-40H,3-4,6-11,13-16,19-20H2,1-2H3,(H3,33,34,36)/t22-,25-,28-,30+,32+/m0/s1 |
| InChIKey | VLERFEAKJQXNSY-IGFHQRHDSA-N |
| XLogP | 2.51 |
| TPSA | 158.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|