C30H48N4O5 — CID 163045088
[(1R,3R)-1-[(2S,4aR,8S,8aS)-8-[(N'-methylcarbamimidoyl)amino]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1-hydroxy-5-(4-hydroxy-3-piperidin-4-yloxyphenyl)pentan-3-yl] acetate (PubChem CID 163045088) has the molecular formula C30H48N4O5 and a molecular weight of 544.74 g/mol. Its IUPAC name is [(1R,3R)-1-[(2S,4aR,8S,8aS)-8-[(N'-methylcarbamimidoyl)amino]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1-hydroxy-5-(4-hydroxy-3-piperidin-4-yloxyphenyl)pentan-3-yl] acetate.
| Compound Name | [(1R,3R)-1-[(2S,4aR,8S,8aS)-8-[(N'-methylcarbamimidoyl)amino]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1-hydroxy-5-(4-hydroxy-3-piperidin-4-yloxyphenyl)pentan-3-yl] acetate |
|---|---|
| PubChem CID | 163045088 |
| Molecular Formula | C30H48N4O5 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.36 |
| IUPAC Name | [(1R,3R)-1-[(2S,4aR,8S,8aS)-8-[(N'-methylcarbamimidoyl)amino]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1-hydroxy-5-(4-hydroxy-3-piperidin-4-yloxyphenyl)pentan-3-yl] acetate |
| SMILES | C/N=C(\N)N[C@H]1CCC[C@@H]2CC[C@H]([C@H](O)C[C@@H](CCc3ccc(O)c(OC4CCNCC4)c3)OC(C)=O)C[C@@H]21 |
| InChI | InChI=1S/C30H48N4O5/c1-19(35)38-24(10-6-20-7-11-27(36)29(16-20)39-23-12-14-33-15-13-23)18-28(37)22-9-8-21-4-3-5-26(25(21)17-22)34-30(31)32-2/h7,11,16,21-26,28,33,36-37H,3-6,8-10,12-15,17-18H2,1-2H3,(H3,31,32,34)/t21-,22+,24-,25+,26+,28-/m1/s1 |
| InChIKey | YHEXWWWEENOIHG-DVSZSNRISA-N |
| XLogP | 3.26 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|