C19H29NO4 — CID 163077627
1-[4-hydroxy-3-methoxy-5-(methylaminomethyl)phenyl]decane-3,5-dione (PubChem CID 163077627) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 1-[4-hydroxy-3-methoxy-5-(methylaminomethyl)phenyl]decane-3,5-dione.
| Compound Name | 1-[4-hydroxy-3-methoxy-5-(methylaminomethyl)phenyl]decane-3,5-dione |
|---|---|
| PubChem CID | 163077627 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 1-[4-hydroxy-3-methoxy-5-(methylaminomethyl)phenyl]decane-3,5-dione |
| SMILES | CCCCCC(=O)CC(=O)CCc1cc(CNC)c(O)c(OC)c1 |
| InChI | InChI=1S/C19H29NO4/c1-4-5-6-7-16(21)12-17(22)9-8-14-10-15(13-20-2)19(23)18(11-14)24-3/h10-11,20,23H,4-9,12-13H2,1-3H3 |
| InChIKey | GJJJOQOTMBDIPP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|