C32H38N2O5 — CID 162794820
5-[4-hydroxy-3-methoxy-5-(methylaminomethyl)phenyl]-1-[(4S,5R)-4-[4-(3-hydroxyphenyl)butyl]-4,5-dihydro-1H-indol-5-yl]pentane-1,3-dione (PubChem CID 162794820) has the molecular formula C32H38N2O5 and a molecular weight of 530.67 g/mol. Its IUPAC name is 5-[4-hydroxy-3-methoxy-5-(methylaminomethyl)phenyl]-1-[(4S,5R)-4-[4-(3-hydroxyphenyl)butyl]-4,5-dihydro-1H-indol-5-yl]pentane-1,3-dione.
| Compound Name | 5-[4-hydroxy-3-methoxy-5-(methylaminomethyl)phenyl]-1-[(4S,5R)-4-[4-(3-hydroxyphenyl)butyl]-4,5-dihydro-1H-indol-5-yl]pentane-1,3-dione |
|---|---|
| PubChem CID | 162794820 |
| Molecular Formula | C32H38N2O5 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 5-[4-hydroxy-3-methoxy-5-(methylaminomethyl)phenyl]-1-[(4S,5R)-4-[4-(3-hydroxyphenyl)butyl]-4,5-dihydro-1H-indol-5-yl]pentane-1,3-dione |
| SMILES | CNCc1cc(CCC(=O)CC(=O)[C@@H]2C=Cc3[nH]ccc3[C@H]2CCCCc2cccc(O)c2)cc(OC)c1O |
| InChI | InChI=1S/C32H38N2O5/c1-33-20-23-16-22(18-31(39-2)32(23)38)10-11-25(36)19-30(37)28-12-13-29-27(14-15-34-29)26(28)9-4-3-6-21-7-5-8-24(35)17-21/h5,7-8,12-18,26,28,33-35,38H,3-4,6,9-11,19-20H2,1-2H3/t26-,28-/m1/s1 |
| InChIKey | OCSVQWWJKAVBBC-IXCJQBJRSA-N |
| XLogP | 5.45 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|