C32H37NO6 — CID 162794850
2-(2-hydroxyethyl)-5-(4-hydroxy-3-methoxyphenyl)-1-[4-[4-(3-hydroxyphenyl)butyl]-4,5-dihydro-1H-indol-5-yl]pentane-1,3-dione (PubChem CID 162794850) has the molecular formula C32H37NO6 and a molecular weight of 531.65 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-5-(4-hydroxy-3-methoxyphenyl)-1-[4-[4-(3-hydroxyphenyl)butyl]-4,5-dihydro-1H-indol-5-yl]pentane-1,3-dione.
| Compound Name | 2-(2-hydroxyethyl)-5-(4-hydroxy-3-methoxyphenyl)-1-[4-[4-(3-hydroxyphenyl)butyl]-4,5-dihydro-1H-indol-5-yl]pentane-1,3-dione |
|---|---|
| PubChem CID | 162794850 |
| Molecular Formula | C32H37NO6 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | 2-(2-hydroxyethyl)-5-(4-hydroxy-3-methoxyphenyl)-1-[4-[4-(3-hydroxyphenyl)butyl]-4,5-dihydro-1H-indol-5-yl]pentane-1,3-dione |
| SMILES | COc1cc(CCC(=O)C(CCO)C(=O)C2C=Cc3[nH]ccc3C2CCCCc2cccc(O)c2)ccc1O |
| InChI | InChI=1S/C32H37NO6/c1-39-31-20-22(10-14-30(31)37)9-13-29(36)27(16-18-34)32(38)26-11-12-28-25(15-17-33-28)24(26)8-3-2-5-21-6-4-7-23(35)19-21/h4,6-7,10-12,14-15,17,19-20,24,26-27,33-35,37H,2-3,5,8-9,13,16,18H2,1H3 |
| InChIKey | NQNPZLGHASTHMR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|