C32H33NO5 — CID 162793613
1-[(4S,5R)-4-[[(7R)-4-hydroxy-8,9-dihydro-7H-benzo[7]annulen-7-yl]methyl]-4,5-dihydro-1H-indol-5-yl]-5-(4-hydroxy-3-methoxyphenyl)pentane-1,3-dione (PubChem CID 162793613) has the molecular formula C32H33NO5 and a molecular weight of 511.62 g/mol. Its IUPAC name is 1-[(4S,5R)-4-[[(7R)-4-hydroxy-8,9-dihydro-7H-benzo[7]annulen-7-yl]methyl]-4,5-dihydro-1H-indol-5-yl]-5-(4-hydroxy-3-methoxyphenyl)pentane-1,3-dione.
| Compound Name | 1-[(4S,5R)-4-[[(7R)-4-hydroxy-8,9-dihydro-7H-benzo[7]annulen-7-yl]methyl]-4,5-dihydro-1H-indol-5-yl]-5-(4-hydroxy-3-methoxyphenyl)pentane-1,3-dione |
|---|---|
| PubChem CID | 162793613 |
| Molecular Formula | C32H33NO5 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 1-[(4S,5R)-4-[[(7R)-4-hydroxy-8,9-dihydro-7H-benzo[7]annulen-7-yl]methyl]-4,5-dihydro-1H-indol-5-yl]-5-(4-hydroxy-3-methoxyphenyl)pentane-1,3-dione |
| SMILES | COc1cc(CCC(=O)CC(=O)[C@@H]2C=Cc3[nH]ccc3[C@H]2C[C@@H]2C=Cc3c(O)cccc3CC2)ccc1O |
| InChI | InChI=1S/C32H33NO5/c1-38-32-18-21(8-14-30(32)36)6-10-23(34)19-31(37)26-12-13-28-25(15-16-33-28)27(26)17-20-5-9-22-3-2-4-29(35)24(22)11-7-20/h2-4,7-8,11-16,18,20,26-27,33,35-36H,5-6,9-10,17,19H2,1H3/t20-,26+,27+/m0/s1 |
| InChIKey | RJFCITYRZCHGLP-MHBGZZOHSA-N |
| XLogP | 5.99 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|