C21H33NO5 — CID 163097670
[1-[4-hydroxy-5-methoxy-2-(methylaminomethyl)phenyl]-3-oxodecan-5-yl] acetate (PubChem CID 163097670) has the molecular formula C21H33NO5 and a molecular weight of 379.50 g/mol. Its IUPAC name is [1-[4-hydroxy-5-methoxy-2-(methylaminomethyl)phenyl]-3-oxodecan-5-yl] acetate.
| Compound Name | [1-[4-hydroxy-5-methoxy-2-(methylaminomethyl)phenyl]-3-oxodecan-5-yl] acetate |
|---|---|
| PubChem CID | 163097670 |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | [1-[4-hydroxy-5-methoxy-2-(methylaminomethyl)phenyl]-3-oxodecan-5-yl] acetate |
| SMILES | CCCCCC(CC(=O)CCc1cc(OC)c(O)cc1CNC)OC(C)=O |
| InChI | InChI=1S/C21H33NO5/c1-5-6-7-8-19(27-15(2)23)13-18(24)10-9-16-12-21(26-4)20(25)11-17(16)14-22-3/h11-12,19,22,25H,5-10,13-14H2,1-4H3 |
| InChIKey | IKQQUJLKEVYKOC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|