C25H44O2S2 — CID 156698134
2-methoxy-4,6-bis(octylsulfanylmethyl)phenol (PubChem CID 156698134) has the molecular formula C25H44O2S2 and a molecular weight of 440.76 g/mol. Its IUPAC name is 2-methoxy-4,6-bis(octylsulfanylmethyl)phenol.
| Compound Name | 2-methoxy-4,6-bis(octylsulfanylmethyl)phenol |
|---|---|
| PubChem CID | 156698134 |
| Molecular Formula | C25H44O2S2 |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 2-methoxy-4,6-bis(octylsulfanylmethyl)phenol |
| SMILES | CCCCCCCCSCc1cc(CSCCCCCCCC)c(O)c(OC)c1 |
| InChI | InChI=1S/C25H44O2S2/c1-4-6-8-10-12-14-16-28-20-22-18-23(25(26)24(19-22)27-3)21-29-17-15-13-11-9-7-5-2/h18-19,26H,4-17,20-21H2,1-3H3 |
| InChIKey | ODSXWWAVQQATGB-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|