C19H32OS2 — CID 141259435
4-methyl-2,6-bis(pentylsulfanylmethyl)phenol (PubChem CID 141259435) has the molecular formula C19H32OS2 and a molecular weight of 340.60 g/mol. Its IUPAC name is 4-methyl-2,6-bis(pentylsulfanylmethyl)phenol.
| Compound Name | 4-methyl-2,6-bis(pentylsulfanylmethyl)phenol |
|---|---|
| PubChem CID | 141259435 |
| Molecular Formula | C19H32OS2 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 4-methyl-2,6-bis(pentylsulfanylmethyl)phenol |
| SMILES | CCCCCSCc1cc(C)cc(CSCCCCC)c1O |
| InChI | InChI=1S/C19H32OS2/c1-4-6-8-10-21-14-17-12-16(3)13-18(19(17)20)15-22-11-9-7-5-2/h12-13,20H,4-11,14-15H2,1-3H3 |
| InChIKey | PSZVNNJJRNPXNS-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|