C15H24OS2 — CID 141259423
4-methyl-2,6-bis(propylsulfanylmethyl)phenol (PubChem CID 141259423) has the molecular formula C15H24OS2 and a molecular weight of 284.49 g/mol. Its IUPAC name is 4-methyl-2,6-bis(propylsulfanylmethyl)phenol.
| Compound Name | 4-methyl-2,6-bis(propylsulfanylmethyl)phenol |
|---|---|
| PubChem CID | 141259423 |
| Molecular Formula | C15H24OS2 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 4-methyl-2,6-bis(propylsulfanylmethyl)phenol |
| SMILES | CCCSCc1cc(C)cc(CSCCC)c1O |
| InChI | InChI=1S/C15H24OS2/c1-4-6-17-10-13-8-12(3)9-14(15(13)16)11-18-7-5-2/h8-9,16H,4-7,10-11H2,1-3H3 |
| InChIKey | NUXUQZSYNOLYOQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|