C18H21F9OS — CID 58330185
2-tert-butyl-4-methyl-6-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanylmethyl)phenol (PubChem CID 58330185) has the molecular formula C18H21F9OS and a molecular weight of 456.41 g/mol. Its IUPAC name is 2-tert-butyl-4-methyl-6-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanylmethyl)phenol.
| Compound Name | 2-tert-butyl-4-methyl-6-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanylmethyl)phenol |
|---|---|
| PubChem CID | 58330185 |
| Molecular Formula | C18H21F9OS |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 2-tert-butyl-4-methyl-6-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanylmethyl)phenol |
| SMILES | Cc1cc(CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H21F9OS/c1-10-7-11(13(28)12(8-10)14(2,3)4)9-29-6-5-15(19,20)16(21,22)17(23,24)18(25,26)27/h7-8,28H,5-6,9H2,1-4H3 |
| InChIKey | RGGXDIWSUUFETI-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|