C39H21F51OS3 — CID 58027799
2,4,6-tris(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethyl)phenol (PubChem CID 58027799) has the molecular formula C39H21F51OS3 and a molecular weight of 1570.70 g/mol. Its IUPAC name is 2,4,6-tris(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethyl)phenol.
| Compound Name | 2,4,6-tris(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethyl)phenol |
|---|---|
| PubChem CID | 58027799 |
| Molecular Formula | C39H21F51OS3 |
| Molecular Weight | 1570.70 g/mol |
| Exact Mass | 1569.99 |
| IUPAC Name | 2,4,6-tris(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethyl)phenol |
| SMILES | Oc1c(CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc(CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C39H21F51OS3/c40-16(41,19(46,47)22(52,53)25(58,59)28(64,65)31(70,71)34(76,77)37(82,83)84)1-4-92-9-12-7-13(10-93-5-2-17(42,43)20(48,49)23(54,55)26(60,61)29(66,67)32(72,73)35(78,79)38(85,86)87)15(91)14(8-12)11-94-6-3-18(44,45)21(50,51)24(56,57)27(62,63)30(68,69)33(74,75)36(80,81)39(88,89)90/h7-8,91H,1-6,9-11H2 |
| InChIKey | JVGXELJFXVPBJU-UHFFFAOYSA-N |
| XLogP | 21.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 94 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1570.70 |
| LogP ≤ 5 | 21.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|