C32H31F26NO2S2 — CID 89024581
[4-methyl-2,6-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanylmethyl)phenyl] N-hexylcarbamate (PubChem CID 89024581) has the molecular formula C32H31F26NO2S2 and a molecular weight of 1019.69 g/mol. Its IUPAC name is [4-methyl-2,6-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanylmethyl)phenyl] N-hexylcarbamate.
| Compound Name | [4-methyl-2,6-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanylmethyl)phenyl] N-hexylcarbamate |
|---|---|
| PubChem CID | 89024581 |
| Molecular Formula | C32H31F26NO2S2 |
| Molecular Weight | 1019.69 g/mol |
| Exact Mass | 1019.14 |
| IUPAC Name | [4-methyl-2,6-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanylmethyl)phenyl] N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)Oc1c(CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc(C)cc1CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C32H31F26NO2S2/c1-3-4-5-6-9-59-20(60)61-19-17(14-62-10-7-21(33,34)23(37,38)25(41,42)27(45,46)29(49,50)31(53,54)55)12-16(2)13-18(19)15-63-11-8-22(35,36)24(39,40)26(43,44)28(47,48)30(51,52)32(56,57)58/h12-13H,3-11,14-15H2,1-2H3,(H,59,60) |
| InChIKey | TXFUTAVLBYBCJY-UHFFFAOYSA-N |
| XLogP | 14.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.69 |
| LogP ≤ 5 | 14.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|