C15H16F15NO2 — CID 88879560
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluorooctyl N-hexylcarbamate (PubChem CID 88879560) has the molecular formula C15H16F15NO2 and a molecular weight of 527.27 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluorooctyl N-hexylcarbamate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluorooctyl N-hexylcarbamate |
|---|---|
| PubChem CID | 88879560 |
| Molecular Formula | C15H16F15NO2 |
| Molecular Weight | 527.27 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluorooctyl N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C15H16F15NO2/c1-2-3-4-5-6-31-8(32)33-15(29,30)14(27,28)13(25,26)12(23,24)11(21,22)10(19,20)9(17,18)7-16/h2-7H2,1H3,(H,31,32) |
| InChIKey | KRSXRZSOPZBWSQ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.27 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|