C16H16F16N2O4 — CID 92905451
[(1R)-1,2,2,3,3,4,4,5-octafluoropentyl] N-[4-[[(1R)-1,2,2,3,3,4,4,5-octafluoropentoxy]carbonylamino]butyl]carbamate (PubChem CID 92905451) has the molecular formula C16H16F16N2O4 and a molecular weight of 604.28 g/mol. Its IUPAC name is [(1R)-1,2,2,3,3,4,4,5-octafluoropentyl] N-[4-[[(1R)-1,2,2,3,3,4,4,5-octafluoropentoxy]carbonylamino]butyl]carbamate.
| Compound Name | [(1R)-1,2,2,3,3,4,4,5-octafluoropentyl] N-[4-[[(1R)-1,2,2,3,3,4,4,5-octafluoropentoxy]carbonylamino]butyl]carbamate |
|---|---|
| PubChem CID | 92905451 |
| Molecular Formula | C16H16F16N2O4 |
| Molecular Weight | 604.28 g/mol |
| Exact Mass | 604.09 |
| IUPAC Name | [(1R)-1,2,2,3,3,4,4,5-octafluoropentyl] N-[4-[[(1R)-1,2,2,3,3,4,4,5-octafluoropentoxy]carbonylamino]butyl]carbamate |
| SMILES | O=C(NCCCCNC(=O)O[C@H](F)C(F)(F)C(F)(F)C(F)(F)CF)O[C@H](F)C(F)(F)C(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C16H16F16N2O4/c17-5-11(21,22)15(29,30)13(25,26)7(19)37-9(35)33-3-1-2-4-34-10(36)38-8(20)14(27,28)16(31,32)12(23,24)6-18/h7-8H,1-6H2,(H,33,35)(H,34,36)/t7-,8-/m0/s1 |
| InChIKey | CINZCEAKLJWYMZ-YUMQZZPRSA-N |
| XLogP | 5.56 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.28 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|