C14H20O2S — CID 107752504
1-[4-hydroxy-3-(pentylsulfanylmethyl)phenyl]ethanone (PubChem CID 107752504) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is 1-[4-hydroxy-3-(pentylsulfanylmethyl)phenyl]ethanone.
| Compound Name | 1-[4-hydroxy-3-(pentylsulfanylmethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 107752504 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 1-[4-hydroxy-3-(pentylsulfanylmethyl)phenyl]ethanone |
| SMILES | CCCCCSCc1cc(C(C)=O)ccc1O |
| InChI | InChI=1S/C14H20O2S/c1-3-4-5-8-17-10-13-9-12(11(2)15)6-7-14(13)16/h6-7,9,16H,3-5,8,10H2,1-2H3 |
| InChIKey | KDGCPYUZFCBCDX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|