C14H20O2S — CID 107746178
2-[2-(pentylsulfanylmethyl)phenyl]acetic acid (PubChem CID 107746178) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is 2-[2-(pentylsulfanylmethyl)phenyl]acetic acid.
| Compound Name | 2-[2-(pentylsulfanylmethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 107746178 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-[2-(pentylsulfanylmethyl)phenyl]acetic acid |
| SMILES | CCCCCSCc1ccccc1CC(=O)O |
| InChI | InChI=1S/C14H20O2S/c1-2-3-6-9-17-11-13-8-5-4-7-12(13)10-14(15)16/h4-5,7-8H,2-3,6,9-11H2,1H3,(H,15,16) |
| InChIKey | GXMCLFQAZLTJMN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|