C23H36N5O4+ — CID 163117731
1-[1-(2,3-dihydro-1H-imidazol-1-ium-1-yl)-11-(4-hydroxy-3-methoxyphenyl)-7,9-dioxoundecan-3-yl]-2-methylguanidine (PubChem CID 163117731) has the molecular formula C23H36N5O4+ and a molecular weight of 446.57 g/mol. Its IUPAC name is 1-[1-(2,3-dihydro-1H-imidazol-1-ium-1-yl)-11-(4-hydroxy-3-methoxyphenyl)-7,9-dioxoundecan-3-yl]-2-methylguanidine.
| Compound Name | 1-[1-(2,3-dihydro-1H-imidazol-1-ium-1-yl)-11-(4-hydroxy-3-methoxyphenyl)-7,9-dioxoundecan-3-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 163117731 |
| Molecular Formula | C23H36N5O4+ |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | 1-[1-(2,3-dihydro-1H-imidazol-1-ium-1-yl)-11-(4-hydroxy-3-methoxyphenyl)-7,9-dioxoundecan-3-yl]-2-methylguanidine |
| SMILES | C/N=C(\N)NC(CCCC(=O)CC(=O)CCc1ccc(O)c(OC)c1)CC[NH+]1C=CNC1 |
| InChI | InChI=1S/C23H35N5O4/c1-25-23(24)27-18(10-12-28-13-11-26-16-28)4-3-5-19(29)15-20(30)8-6-17-7-9-21(31)22(14-17)32-2/h7,9,11,13-14,18,26,31H,3-6,8,10,12,15-16H2,1-2H3,(H3,24,25,27)/p+1 |
| InChIKey | AKQLJZDKIHOGKJ-UHFFFAOYSA-O |
| XLogP | 0.24 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|