C16H39N3O2Si2 — CID 59428058
2-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yl]guanidine (PubChem CID 59428058) has the molecular formula C16H39N3O2Si2 and a molecular weight of 361.68 g/mol. Its IUPAC name is 2-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yl]guanidine.
| Compound Name | 2-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yl]guanidine |
|---|---|
| PubChem CID | 59428058 |
| Molecular Formula | C16H39N3O2Si2 |
| Molecular Weight | 361.68 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 2-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-yl]guanidine |
| SMILES | CC(C)(C)[Si](C)(C)OCC(CO[Si](C)(C)C(C)(C)C)N=C(N)N |
| InChI | InChI=1S/C16H39N3O2Si2/c1-15(2,3)22(7,8)20-11-13(19-14(17)18)12-21-23(9,10)16(4,5)6/h13H,11-12H2,1-10H3,(H4,17,18,19) |
| InChIKey | SEXVMKZMZMYXCM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.68 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|