C26H54O3S2Si2 — CID 59051785
(2S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]-1,3-dithian-2-yl]pentan-2-ol (PubChem CID 59051785) has the molecular formula C26H54O3S2Si2 and a molecular weight of 535.02 g/mol. Its IUPAC name is (2S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]-1,3-dithian-2-yl]pentan-2-ol.
| Compound Name | (2S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]-1,3-dithian-2-yl]pentan-2-ol |
|---|---|
| PubChem CID | 59051785 |
| Molecular Formula | C26H54O3S2Si2 |
| Molecular Weight | 535.02 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | (2S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[2-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl]-1,3-dithian-2-yl]pentan-2-ol |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C1(C[C@@H](O)CCCO[Si](C)(C)C(C)(C)C)SCCCS1 |
| InChI | InChI=1S/C26H54O3S2Si2/c1-13-23(29-33(11,12)25(6,7)8)21(2)26(30-18-15-19-31-26)20-22(27)16-14-17-28-32(9,10)24(3,4)5/h13,21-23,27H,1,14-20H2,2-12H3/t21-,22+,23+/m1/s1 |
| InChIKey | LZWNHKSJEPOBNW-VJBWXMMDSA-N |
| XLogP | 8.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.02 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|