C16H32O2Si — CID 23253498
(E,4R,5S)-8-[tert-butyl(dimethyl)silyl]oxy-5-ethenyloct-2-en-4-ol (PubChem CID 23253498) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is (E,4R,5S)-8-[tert-butyl(dimethyl)silyl]oxy-5-ethenyloct-2-en-4-ol.
| Compound Name | (E,4R,5S)-8-[tert-butyl(dimethyl)silyl]oxy-5-ethenyloct-2-en-4-ol |
|---|---|
| PubChem CID | 23253498 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | (E,4R,5S)-8-[tert-butyl(dimethyl)silyl]oxy-5-ethenyloct-2-en-4-ol |
| SMILES | C=C[C@H](CCCO[Si](C)(C)C(C)(C)C)[C@H](O)/C=C/C |
| InChI | InChI=1S/C16H32O2Si/c1-8-11-15(17)14(9-2)12-10-13-18-19(6,7)16(3,4)5/h8-9,11,14-15,17H,2,10,12-13H2,1,3-7H3/b11-8+/t14-,15-/m1/s1 |
| InChIKey | FFTWSXWWKOBKLY-UHUXCJHTSA-N |
| XLogP | 4.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|