C22H38BNO4 — CID 163947723
tert-butyl N-[1-[(1E,5Z)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-1,5-dienyl]cyclobutyl]carbamate (PubChem CID 163947723) has the molecular formula C22H38BNO4 and a molecular weight of 391.36 g/mol. Its IUPAC name is tert-butyl N-[1-[(1E,5Z)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-1,5-dienyl]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[(1E,5Z)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-1,5-dienyl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 163947723 |
| Molecular Formula | C22H38BNO4 |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | tert-butyl N-[1-[(1E,5Z)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-1,5-dienyl]cyclobutyl]carbamate |
| SMILES | C/C=C\C(C/C=C/C1(NC(=O)OC(C)(C)C)CCC1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H38BNO4/c1-9-12-17(23-27-20(5,6)21(7,8)28-23)13-10-14-22(15-11-16-22)24-18(25)26-19(2,3)4/h9-10,12,14,17H,11,13,15-16H2,1-8H3,(H,24,25)/b12-9-,14-10+ |
| InChIKey | RWPMRWWXMJAUHB-SPEXVAAVSA-N |
| XLogP | 5.42 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|