C9H17N3O2 — CID 153338827
tert-butyl N-[(1S)-1-(3-methyldiazirin-3-yl)ethyl]carbamate (PubChem CID 153338827) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(3-methyldiazirin-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(3-methyldiazirin-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 153338827 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | tert-butyl N-[(1S)-1-(3-methyldiazirin-3-yl)ethyl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C1(C)N=N1 |
| InChI | InChI=1S/C9H17N3O2/c1-6(9(5)11-12-9)10-7(13)14-8(2,3)4/h6H,1-5H3,(H,10,13)/t6-/m0/s1 |
| InChIKey | NRDFAIPGXZUKMH-LURJTMIESA-N |
| XLogP | 2.08 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |