C12H13N5O3S — CID 104741346
3-amino-N-[3-(sulfamoylamino)phenyl]pyridine-2-carboxamide (PubChem CID 104741346) has the molecular formula C12H13N5O3S and a molecular weight of 307.34 g/mol. Its IUPAC name is 3-amino-N-[3-(sulfamoylamino)phenyl]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[3-(sulfamoylamino)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 104741346 |
| Molecular Formula | C12H13N5O3S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 3-amino-N-[3-(sulfamoylamino)phenyl]pyridine-2-carboxamide |
| SMILES | Nc1cccnc1C(=O)Nc1cccc(NS(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H13N5O3S/c13-10-5-2-6-15-11(10)12(18)16-8-3-1-4-9(7-8)17-21(14,19)20/h1-7,17H,13H2,(H,16,18)(H2,14,19,20) |
| InChIKey | OFXOYYNEJKJVTB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 140.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |