C12H10BClN3OS — CID 154643103
CID 154643103 (PubChem CID 154643103) has the molecular formula C12H10BClN3OS and a molecular weight of 290.56 g/mol.
| Compound Name | CID 154643103 |
|---|---|
| PubChem CID | 154643103 |
| Molecular Formula | C12H10BClN3OS |
| Molecular Weight | 290.56 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | — |
| SMILES | Nc1cccnc1C(=O)Nc1ccc(Cl)c([B]S)c1 |
| InChI | InChI=1S/C12H10BClN3OS/c14-9-4-3-7(6-8(9)13-19)17-12(18)11-10(15)2-1-5-16-11/h1-6,19H,15H2,(H,17,18) |
| InChIKey | IJTLFLKNIVUZIQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.56 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|