C13H9Cl2N3O3 — CID 104742777
4-[(3-aminopyridine-2-carbonyl)amino]-3,5-dichlorobenzoic acid (PubChem CID 104742777) has the molecular formula C13H9Cl2N3O3 and a molecular weight of 326.14 g/mol. Its IUPAC name is 4-[(3-aminopyridine-2-carbonyl)amino]-3,5-dichlorobenzoic acid.
| Compound Name | 4-[(3-aminopyridine-2-carbonyl)amino]-3,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 104742777 |
| Molecular Formula | C13H9Cl2N3O3 |
| Molecular Weight | 326.14 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | 4-[(3-aminopyridine-2-carbonyl)amino]-3,5-dichlorobenzoic acid |
| SMILES | Nc1cccnc1C(=O)Nc1c(Cl)cc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C13H9Cl2N3O3/c14-7-4-6(13(20)21)5-8(15)10(7)18-12(19)11-9(16)2-1-3-17-11/h1-5H,16H2,(H,18,19)(H,20,21) |
| InChIKey | XCAVJWZSEVYWLY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.14 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |