C12H13N3O4S — CID 60728536
3-methyl-N-[3-(sulfamoylamino)phenyl]furan-2-carboxamide (PubChem CID 60728536) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is 3-methyl-N-[3-(sulfamoylamino)phenyl]furan-2-carboxamide.
| Compound Name | 3-methyl-N-[3-(sulfamoylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 60728536 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3-methyl-N-[3-(sulfamoylamino)phenyl]furan-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)Nc1cccc(NS(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H13N3O4S/c1-8-5-6-19-11(8)12(16)14-9-3-2-4-10(7-9)15-20(13,17)18/h2-7,15H,1H3,(H,14,16)(H2,13,17,18) |
| InChIKey | AZLKCJCQYPYXGT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |