C18H18N4O3S — CID 86920862
N-(4-imidazol-1-ylphenyl)-3,4-dimethyl-5-sulfamoylbenzamide (PubChem CID 86920862) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-(4-imidazol-1-ylphenyl)-3,4-dimethyl-5-sulfamoylbenzamide.
| Compound Name | N-(4-imidazol-1-ylphenyl)-3,4-dimethyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 86920862 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-(4-imidazol-1-ylphenyl)-3,4-dimethyl-5-sulfamoylbenzamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(-n3ccnc3)cc2)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C18H18N4O3S/c1-12-9-14(10-17(13(12)2)26(19,24)25)18(23)21-15-3-5-16(6-4-15)22-8-7-20-11-22/h3-11H,1-2H3,(H,21,23)(H2,19,24,25) |
| InChIKey | ICTBYCPPVDQOFP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |