C19H19N3O3S2 — CID 31075764
1-[3-[(2,5-dimethylthiophen-3-yl)sulfonylamino]phenyl]-3-phenylurea (PubChem CID 31075764) has the molecular formula C19H19N3O3S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 1-[3-[(2,5-dimethylthiophen-3-yl)sulfonylamino]phenyl]-3-phenylurea.
| Compound Name | 1-[3-[(2,5-dimethylthiophen-3-yl)sulfonylamino]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 31075764 |
| Molecular Formula | C19H19N3O3S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 1-[3-[(2,5-dimethylthiophen-3-yl)sulfonylamino]phenyl]-3-phenylurea |
| SMILES | Cc1cc(S(=O)(=O)Nc2cccc(NC(=O)Nc3ccccc3)c2)c(C)s1 |
| InChI | InChI=1S/C19H19N3O3S2/c1-13-11-18(14(2)26-13)27(24,25)22-17-10-6-9-16(12-17)21-19(23)20-15-7-4-3-5-8-15/h3-12,22H,1-2H3,(H2,20,21,23) |
| InChIKey | MJXRELWWAYJIDS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |