C12H12NO3S2- — CID 3378223
3-[(2,5-dimethylthiophen-3-yl)sulfonylamino]phenolate (PubChem CID 3378223) has the molecular formula C12H12NO3S2- and a molecular weight of 282.37 g/mol. Its IUPAC name is 3-[(2,5-dimethylthiophen-3-yl)sulfonylamino]phenolate.
| Compound Name | 3-[(2,5-dimethylthiophen-3-yl)sulfonylamino]phenolate |
|---|---|
| PubChem CID | 3378223 |
| Molecular Formula | C12H12NO3S2- |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 3-[(2,5-dimethylthiophen-3-yl)sulfonylamino]phenolate |
| SMILES | Cc1cc(S(=O)(=O)Nc2cccc([O-])c2)c(C)s1 |
| InChI | InChI=1S/C12H13NO3S2/c1-8-6-12(9(2)17-8)18(15,16)13-10-4-3-5-11(14)7-10/h3-7,13-14H,1-2H3/p-1 |
| InChIKey | UITRGYSMQPNGIY-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |