C15H15N3O2S2 — CID 39837092
2,5-dimethyl-N-(4-pyrazol-1-ylphenyl)thiophene-3-sulfonamide (PubChem CID 39837092) has the molecular formula C15H15N3O2S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 2,5-dimethyl-N-(4-pyrazol-1-ylphenyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dimethyl-N-(4-pyrazol-1-ylphenyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 39837092 |
| Molecular Formula | C15H15N3O2S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 2,5-dimethyl-N-(4-pyrazol-1-ylphenyl)thiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(-n3cccn3)cc2)c(C)s1 |
| InChI | InChI=1S/C15H15N3O2S2/c1-11-10-15(12(2)21-11)22(19,20)17-13-4-6-14(7-5-13)18-9-3-8-16-18/h3-10,17H,1-2H3 |
| InChIKey | FVIRURPAKUHBKV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |