C14H15NO3S2 — CID 39769709
N-(3-acetylphenyl)-2,5-dimethylthiophene-3-sulfonamide (PubChem CID 39769709) has the molecular formula C14H15NO3S2 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2,5-dimethylthiophene-3-sulfonamide.
| Compound Name | N-(3-acetylphenyl)-2,5-dimethylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 39769709 |
| Molecular Formula | C14H15NO3S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | N-(3-acetylphenyl)-2,5-dimethylthiophene-3-sulfonamide |
| SMILES | CC(=O)c1cccc(NS(=O)(=O)c2cc(C)sc2C)c1 |
| InChI | InChI=1S/C14H15NO3S2/c1-9-7-14(11(3)19-9)20(17,18)15-13-6-4-5-12(8-13)10(2)16/h4-8,15H,1-3H3 |
| InChIKey | CHJPGNXSXCSXGU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |